Contents of mercury, cadmium and lead in edible mushrooms and in underlying substrates from a rural area with an occurrence of serpentines and amphiboles

Autor Chrastný, Vladislav, Fiala, Přemysl, Kalač, Pavel, Nováčková, Jarmila, Svoboda, Lubomír
Zdroj: 1. Ekológia (Bratislava) 1. 1335-342X 1. Roč. 26, č. 3 (2007), s. 322-329

The use dynamic (window) sampling in the site investigation of potentially contaminated ground

Autor Eccles, C.S, Redford, R.P
Zdroj: 1. Engineering geology 1. 0013-7952 1. Roč. 53, č. 2 (jún 1999), s. 125-130

Mimetite formation from goethite adsorbed arsenate

Autor Bajda, T., Bogucka, A., Manecki, M., Mozgawa, W.
Zdroj: 1. Mineralia slovaca 1. 0369-2086 1. Roč. 38, č. 4 (2006)
2. [Príl.] Geovestník 2. 0369-2086 2. Č. 4 (2006), s. 4

Anionic substitutions in the lead apatites series Pb10(PO4)6Cl2-Pb10(AsO4)6Cl2-Pb10(VO4)6Cl2 (preliminary results)

Autor Bajda, T., Flis, J., Manecki, M., Mozgawa, W.
Zdroj: 1. Mineralia slovaca 1. 0369-2086 1. Roč. 38, č. 4 (2006)
2. [Príl.] Geovestník 2. 0369-2086 2. Č. 4 (2006), s. 5

Immobilization of lead from aqueous solutions using fertilizers

Autor Wegner, M., Bajda, T., Manecki, M.
Zdroj: 1. Mineralia slovaca 1. 0369-2086 1. Roč. 38, č. 4 (2006)
2. [Príl.] Geovestník 2. 0369-2086 2. Č. 4 (2006), s. 14-15

Reaction of Cd sorbed on ferrihydrite with phosphate ions

Autor Bajda, T., Manecki, M., Matusik, J., Wojnarski, D.
Zdroj: 1. Mineralia slovaca 1. 0369-2086 1. Roč. 38, č. 4 (2006)
2. [Príl.] Geovestník 2. 0369-2086 2. Č. 4 (2006), s. 15

Use of equilibrium and initial metal concentrations in determining Freundlich isotherms for soils and sediments

Autor Coles, Cynthia A., Yong, Raymond N.
Zdroj: 1. Engineering geology 1. 0013-7952 1. Roč. 85, č. 1-2 (máj 2006), s. 19-25

Humic acid preparation, properties and interactions with metals lead and cadmium

Autor Coles, Cynthia A., Yong, Raymond N.
Zdroj: 1. Engineering geology 1. 0013-7952 1. Roč. 85, č. 1-2 (máj 2006), s. 26-32

Sanace znečištěné půdy

Autor Tichý, Richard, Grotenhus, J.T.C
Zdroj: 1. Informační zpravodaj koksárenství. Technický zpravodaj 1. 0862-3287 1. Roč. 42, č. 1 (1997), s. 3-4

Immobilization of aqueous cadmium by addition of phosphates

Autor Matusik, J., Bajda, Tomasz, Manecki, Maciej
Zdroj: 1. Mineralia slovaca 1. 0369-2086 1. Roč. 39, č. 2 (2007)
2. [Príl.] Geovestník 2. 0369-2086 2. Č. 2 (2007), s. 13-14

Möglichkeiten und Grenzen biologischer Bodensanierungene

Autor Wachtendonk, Andreas von, Wachtendonk, Dettmar von
Zdroj: 1. Informační zpravodaj koksárenství. Technický zpravodaj 1. 0862-3287 1. Roč. 41, č. 1 (1996), s. 38-55